C12H15BrFNO2 — CID 117489148
3-[1-(aminomethyl)cyclobutyl]-4-bromo-6-fluoro-2-methoxyphenol (PubChem CID 117489148) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 3-[1-(aminomethyl)cyclobutyl]-4-bromo-6-fluoro-2-methoxyphenol.
| Compound Name | 3-[1-(aminomethyl)cyclobutyl]-4-bromo-6-fluoro-2-methoxyphenol |
|---|---|
| PubChem CID | 117489148 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-[1-(aminomethyl)cyclobutyl]-4-bromo-6-fluoro-2-methoxyphenol |
| SMILES | COc1c(O)c(F)cc(Br)c1C1(CN)CCC1 |
| InChI | InChI=1S/C12H15BrFNO2/c1-17-11-9(12(6-15)3-2-4-12)7(13)5-8(14)10(11)16/h5,16H,2-4,6,15H2,1H3 |
| InChIKey | FXQYPRYTQCZHHN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |