C12H15BrFNO2 — CID 117489156
1-(6-bromo-4-fluoro-2,3-dimethoxyphenyl)cyclobutan-1-amine (PubChem CID 117489156) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 1-(6-bromo-4-fluoro-2,3-dimethoxyphenyl)cyclobutan-1-amine.
| Compound Name | 1-(6-bromo-4-fluoro-2,3-dimethoxyphenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 117489156 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-(6-bromo-4-fluoro-2,3-dimethoxyphenyl)cyclobutan-1-amine |
| SMILES | COc1c(F)cc(Br)c(C2(N)CCC2)c1OC |
| InChI | InChI=1S/C12H15BrFNO2/c1-16-10-8(14)6-7(13)9(11(10)17-2)12(15)4-3-5-12/h6H,3-5,15H2,1-2H3 |
| InChIKey | GSXQBVZITQUJQE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |