C18H26O5 — CID 11738783
methyl 2-[(2S,3R,4S,6R)-4-hydroxy-3-methyl-6-(2-phenylmethoxyethyl)oxan-2-yl]acetate (PubChem CID 11738783) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,6R)-4-hydroxy-3-methyl-6-(2-phenylmethoxyethyl)oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4S,6R)-4-hydroxy-3-methyl-6-(2-phenylmethoxyethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 11738783 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl 2-[(2S,3R,4S,6R)-4-hydroxy-3-methyl-6-(2-phenylmethoxyethyl)oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](CCOCc2ccccc2)C[C@H](O)[C@H]1C |
| InChI | InChI=1S/C18H26O5/c1-13-16(19)10-15(23-17(13)11-18(20)21-2)8-9-22-12-14-6-4-3-5-7-14/h3-7,13,15-17,19H,8-12H2,1-2H3/t13-,15-,16+,17+/m1/s1 |
| InChIKey | PNNCGVYZGYLHHI-SIXLDLHFSA-N |
| XLogP | 2.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|