2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid

C16H15Cl2NO2 — CID 11738825

IUPAC2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid
SMILESCCc1ccc(Nc2c(C)cc(Cl)cc2Cl)c(C(=O)O)c1
InChIInChI=1S/C16H15Cl2NO2/c1-3-10-4-5-14(12(7-10)16(20)21)19-15-9(2)6-11(17)8-13(15)18/h4-8,19H,3H2,1-2H3,(H,20,21)
InChIKeyWKEUBQHTHOYHHG-UHFFFAOYSA-N
MW324.21 g/mol
LogP5.31
Rot. Bonds4

About 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid

2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid (PubChem CID 11738825) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid.

Molecular Properties

Compound Name2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid
PubChem CID11738825
Molecular FormulaC16H15Cl2NO2
Molecular Weight324.21 g/mol
Exact Mass323.05
IUPAC Name2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid
SMILESCCc1ccc(Nc2c(C)cc(Cl)cc2Cl)c(C(=O)O)c1
InChIInChI=1S/C16H15Cl2NO2/c1-3-10-4-5-14(12(7-10)16(20)21)19-15-9(2)6-11(17)8-13(15)18/h4-8,19H,3H2,1-2H3,(H,20,21)
InChIKeyWKEUBQHTHOYHHG-UHFFFAOYSA-N
XLogP5.31
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500324.21
LogP ≤ 55.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid?
The IUPAC name of 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid (CID 11738825) is 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid.
What is the SMILES notation for 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid?
The canonical SMILES for 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid is CCc1ccc(Nc2c(C)cc(Cl)cc2Cl)c(C(=O)O)c1.
What is the InChIKey of 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid?
The InChIKey is WKEUBQHTHOYHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO2/c1-3-10-4-5-14(12(7-10)16(20)21)19-15-9(2)6-11(17)8-13(15)18/h4-8,19H,3H2,1-2H3,(H,20,21).
What are the key properties of 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid?
2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid has a molecular weight of 324.21 g/mol, XLogP of 5.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichloro-6-methylanilino)-5-ethylbenzoic acid is sourced from PubChem (CID 11738825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).