C12H12F2N2O2 — CID 117388330
5-[3-(1,1-difluoroethyl)-2-methoxyphenyl]-1,2-oxazol-3-amine (PubChem CID 117388330) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is 5-[3-(1,1-difluoroethyl)-2-methoxyphenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[3-(1,1-difluoroethyl)-2-methoxyphenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117388330 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-[3-(1,1-difluoroethyl)-2-methoxyphenyl]-1,2-oxazol-3-amine |
| SMILES | COc1c(-c2cc(N)no2)cccc1C(C)(F)F |
| InChI | InChI=1S/C12H12F2N2O2/c1-12(13,14)8-5-3-4-7(11(8)17-2)9-6-10(15)16-18-9/h3-6H,1-2H3,(H2,15,16) |
| InChIKey | TYPOUQCWSJHCEI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |