About 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid
5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid (PubChem CID 117388809) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid.
Analyze 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid?
The IUPAC name of 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid (CID 117388809) is 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid.
What is the SMILES notation for 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid?
The canonical SMILES for 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid is COc1cc(OC)c(C(C)(C)CO)cc1C(=O)O.
What is the InChIKey of 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid?
The InChIKey is IYVWGCUNVDSRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5/c1-13(2,7-14)9-5-8(12(15)16)10(17-3)6-11(9)18-4/h5-6,14H,7H2,1-4H3,(H,15,16).
What are the key properties of 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid?
5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid has a molecular weight of 254.28 g/mol, XLogP of 1.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-hydroxy-2-methylpropan-2-yl)-2,4-dimethoxybenzoic acid is sourced from PubChem (CID 117388809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).