C12H17FO4S — CID 117442386
2-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-2-methylpropan-1-ol (PubChem CID 117442386) has the molecular formula C12H17FO4S and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-2-methylpropan-1-ol.
| Compound Name | 2-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117442386 |
| Molecular Formula | C12H17FO4S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-(5-fluoro-2-methoxy-4-methylsulfonylphenyl)-2-methylpropan-1-ol |
| SMILES | COc1cc(S(C)(=O)=O)c(F)cc1C(C)(C)CO |
| InChI | InChI=1S/C12H17FO4S/c1-12(2,7-14)8-5-9(13)11(18(4,15)16)6-10(8)17-3/h5-6,14H,7H2,1-4H3 |
| InChIKey | ZPLADTDWRBKVMC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |