C11H14F2O3S — CID 117414933
2-(2,5-difluoro-3-methylsulfonylphenyl)-2-methylpropan-1-ol (PubChem CID 117414933) has the molecular formula C11H14F2O3S and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-methylpropan-1-ol.
| Compound Name | 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117414933 |
| Molecular Formula | C11H14F2O3S |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)c1cc(F)cc(S(C)(=O)=O)c1F |
| InChI | InChI=1S/C11H14F2O3S/c1-11(2,6-14)8-4-7(12)5-9(10(8)13)17(3,15)16/h4-5,14H,6H2,1-3H3 |
| InChIKey | SBBSHKHCHYWCMR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |