C10H10F2O4S — CID 117414591
3-(2,5-difluoro-3-methylsulfonylphenyl)propanoic acid (PubChem CID 117414591) has the molecular formula C10H10F2O4S and a molecular weight of 264.25 g/mol. Its IUPAC name is 3-(2,5-difluoro-3-methylsulfonylphenyl)propanoic acid.
| Compound Name | 3-(2,5-difluoro-3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117414591 |
| Molecular Formula | C10H10F2O4S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 3-(2,5-difluoro-3-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1cc(F)cc(CCC(=O)O)c1F |
| InChI | InChI=1S/C10H10F2O4S/c1-17(15,16)8-5-7(11)4-6(10(8)12)2-3-9(13)14/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | WDUIUDVLXMYBIO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |