C9H9F2NO4S — CID 117416606
2-amino-2-(2,5-difluoro-3-methylsulfonylphenyl)acetic acid (PubChem CID 117416606) has the molecular formula C9H9F2NO4S and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-amino-2-(2,5-difluoro-3-methylsulfonylphenyl)acetic acid.
| Compound Name | 2-amino-2-(2,5-difluoro-3-methylsulfonylphenyl)acetic acid |
|---|---|
| PubChem CID | 117416606 |
| Molecular Formula | C9H9F2NO4S |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-amino-2-(2,5-difluoro-3-methylsulfonylphenyl)acetic acid |
| SMILES | CS(=O)(=O)c1cc(F)cc(C(N)C(=O)O)c1F |
| InChI | InChI=1S/C9H9F2NO4S/c1-17(15,16)6-3-4(10)2-5(7(6)11)8(12)9(13)14/h2-3,8H,12H2,1H3,(H,13,14) |
| InChIKey | LOJIRGWYXFVZEZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |