C10H13NO4S2 — CID 117440393
2-amino-2-(2-methylsulfanyl-3-methylsulfonylphenyl)acetic acid (PubChem CID 117440393) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-amino-2-(2-methylsulfanyl-3-methylsulfonylphenyl)acetic acid.
| Compound Name | 2-amino-2-(2-methylsulfanyl-3-methylsulfonylphenyl)acetic acid |
|---|---|
| PubChem CID | 117440393 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-amino-2-(2-methylsulfanyl-3-methylsulfonylphenyl)acetic acid |
| SMILES | CSc1c(C(N)C(=O)O)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C10H13NO4S2/c1-16-9-6(8(11)10(12)13)4-3-5-7(9)17(2,14)15/h3-5,8H,11H2,1-2H3,(H,12,13) |
| InChIKey | MWVOZEWTAKHFSL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |