C9H10FNO4S — CID 66512702
(2S)-2-amino-2-(5-fluoro-2-methylsulfonylphenyl)acetic acid (PubChem CID 66512702) has the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. Its IUPAC name is (2S)-2-amino-2-(5-fluoro-2-methylsulfonylphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(5-fluoro-2-methylsulfonylphenyl)acetic acid |
|---|---|
| PubChem CID | 66512702 |
| Molecular Formula | C9H10FNO4S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (2S)-2-amino-2-(5-fluoro-2-methylsulfonylphenyl)acetic acid |
| SMILES | CS(=O)(=O)c1ccc(F)cc1[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H10FNO4S/c1-16(14,15)7-3-2-5(10)4-6(7)8(11)9(12)13/h2-4,8H,11H2,1H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | QAALGCVJMWWEBR-QMMMGPOBSA-N |
| XLogP | 0.31 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |