C12H18O3S2 — CID 117438762
2-methyl-2-(2-methylsulfanyl-3-methylsulfonylphenyl)propan-1-ol (PubChem CID 117438762) has the molecular formula C12H18O3S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-methyl-2-(2-methylsulfanyl-3-methylsulfonylphenyl)propan-1-ol.
| Compound Name | 2-methyl-2-(2-methylsulfanyl-3-methylsulfonylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117438762 |
| Molecular Formula | C12H18O3S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-methyl-2-(2-methylsulfanyl-3-methylsulfonylphenyl)propan-1-ol |
| SMILES | CSc1c(C(C)(C)CO)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C12H18O3S2/c1-12(2,8-13)9-6-5-7-10(11(9)16-3)17(4,14)15/h5-7,13H,8H2,1-4H3 |
| InChIKey | RWBKFPJKFMNVAW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |