3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid

C12H16O2S2 — CID 117394680

IUPAC3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid
SMILESCSc1ccc(CC(C)C(=O)O)cc1SC
InChIInChI=1S/C12H16O2S2/c1-8(12(13)14)6-9-4-5-10(15-2)11(7-9)16-3/h4-5,7-8H,6H2,1-3H3,(H,13,14)
InChIKeyDRIVJAWUSOUFMY-UHFFFAOYSA-N
MW256.39 g/mol
LogP3.39
Rot. Bonds5

About 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid

3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid (PubChem CID 117394680) has the molecular formula C12H16O2S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid.

Molecular Properties

Compound Name3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid
PubChem CID117394680
Molecular FormulaC12H16O2S2
Molecular Weight256.39 g/mol
Exact Mass256.06
IUPAC Name3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid
SMILESCSc1ccc(CC(C)C(=O)O)cc1SC
InChIInChI=1S/C12H16O2S2/c1-8(12(13)14)6-9-4-5-10(15-2)11(7-9)16-3/h4-5,7-8H,6H2,1-3H3,(H,13,14)
InChIKeyDRIVJAWUSOUFMY-UHFFFAOYSA-N
XLogP3.39
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.39
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid?
The IUPAC name of 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid (CID 117394680) is 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid.
What is the SMILES notation for 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid?
The canonical SMILES for 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid is CSc1ccc(CC(C)C(=O)O)cc1SC.
What is the InChIKey of 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid?
The InChIKey is DRIVJAWUSOUFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S2/c1-8(12(13)14)6-9-4-5-10(15-2)11(7-9)16-3/h4-5,7-8H,6H2,1-3H3,(H,13,14).
What are the key properties of 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid?
3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid has a molecular weight of 256.39 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid is sourced from PubChem (CID 117394680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).