C12H16O2S2 — CID 117394680
3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid (PubChem CID 117394680) has the molecular formula C12H16O2S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117394680 |
| Molecular Formula | C12H16O2S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-[3,4-bis(methylsulfanyl)phenyl]-2-methylpropanoic acid |
| SMILES | CSc1ccc(CC(C)C(=O)O)cc1SC |
| InChI | InChI=1S/C12H16O2S2/c1-8(12(13)14)6-9-4-5-10(15-2)11(7-9)16-3/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
| InChIKey | DRIVJAWUSOUFMY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |