C11H13BrO2S — CID 117467082
3-(5-bromo-2-methylsulfanylphenyl)-2-methylpropanoic acid (PubChem CID 117467082) has the molecular formula C11H13BrO2S and a molecular weight of 289.19 g/mol. Its IUPAC name is 3-(5-bromo-2-methylsulfanylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(5-bromo-2-methylsulfanylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117467082 |
| Molecular Formula | C11H13BrO2S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 3-(5-bromo-2-methylsulfanylphenyl)-2-methylpropanoic acid |
| SMILES | CSc1ccc(Br)cc1CC(C)C(=O)O |
| InChI | InChI=1S/C11H13BrO2S/c1-7(11(13)14)5-8-6-9(12)3-4-10(8)15-2/h3-4,6-7H,5H2,1-2H3,(H,13,14) |
| InChIKey | WLJQIRRDIVGPGR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |