C22H33NO3 — CID 11739876
ethyl 3-cyclohexyl-3-[(4-methoxyphenyl)methyl-prop-2-enylamino]propanoate (PubChem CID 11739876) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-3-[(4-methoxyphenyl)methyl-prop-2-enylamino]propanoate.
| Compound Name | ethyl 3-cyclohexyl-3-[(4-methoxyphenyl)methyl-prop-2-enylamino]propanoate |
|---|---|
| PubChem CID | 11739876 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | ethyl 3-cyclohexyl-3-[(4-methoxyphenyl)methyl-prop-2-enylamino]propanoate |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(CC(=O)OCC)C1CCCCC1 |
| InChI | InChI=1S/C22H33NO3/c1-4-15-23(17-18-11-13-20(25-3)14-12-18)21(16-22(24)26-5-2)19-9-7-6-8-10-19/h4,11-14,19,21H,1,5-10,15-17H2,2-3H3 |
| InChIKey | ZNAKJWBWABOTIM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|