About 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid
2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid (PubChem CID 117399290) has the molecular formula C11H14O5S
and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid.
Analyze 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid?
The IUPAC name of 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid (CID 117399290) is 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid is COc1cc(C(O)C(=O)O)cc(SC)c1OC.
What is the InChIKey of 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid?
The InChIKey is DVAQBPKIBSURLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5S/c1-15-7-4-6(9(12)11(13)14)5-8(17-3)10(7)16-2/h4-5,9,12H,1-3H3,(H,13,14).
What are the key properties of 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid?
2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid has a molecular weight of 258.29 g/mol, XLogP of 1.54, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxy-5-methylsulfanylphenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 117399290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).