C10H11FO6S — CID 117445755
2-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-hydroxyacetic acid (PubChem CID 117445755) has the molecular formula C10H11FO6S and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117445755 |
| Molecular Formula | C10H11FO6S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(C(O)C(=O)O)cc(F)c1S(C)(=O)=O |
| InChI | InChI=1S/C10H11FO6S/c1-17-7-4-5(8(12)10(13)14)3-6(11)9(7)18(2,15)16/h3-4,8,12H,1-2H3,(H,13,14) |
| InChIKey | OLLTVKDEPXNWRG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |