C14H18N4O — CID 117399628
[3-(2-piperidin-1-ylphenyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 117399628) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is [3-(2-piperidin-1-ylphenyl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-(2-piperidin-1-ylphenyl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 117399628 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [3-(2-piperidin-1-ylphenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | NCc1nc(-c2ccccc2N2CCCCC2)no1 |
| InChI | InChI=1S/C14H18N4O/c15-10-13-16-14(17-19-13)11-6-2-3-7-12(11)18-8-4-1-5-9-18/h2-3,6-7H,1,4-5,8-10,15H2 |
| InChIKey | QDHFGJQWDMHTSQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |