C12H15ClFNO2 — CID 117403423
3-amino-3-[3-chloro-2-(2-fluoropropan-2-yl)phenyl]propanoic acid (PubChem CID 117403423) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 3-amino-3-[3-chloro-2-(2-fluoropropan-2-yl)phenyl]propanoic acid.
| Compound Name | 3-amino-3-[3-chloro-2-(2-fluoropropan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117403423 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-amino-3-[3-chloro-2-(2-fluoropropan-2-yl)phenyl]propanoic acid |
| SMILES | CC(C)(F)c1c(Cl)cccc1C(N)CC(=O)O |
| InChI | InChI=1S/C12H15ClFNO2/c1-12(2,14)11-7(4-3-5-8(11)13)9(15)6-10(16)17/h3-5,9H,6,15H2,1-2H3,(H,16,17) |
| InChIKey | CPIZITLVPGVQIE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |