C15H20N2O2 — CID 117405269
3-(3-tert-butyl-4-methoxy-5-methylphenyl)-1,2-oxazol-5-amine (PubChem CID 117405269) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(3-tert-butyl-4-methoxy-5-methylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-tert-butyl-4-methoxy-5-methylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117405269 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-(3-tert-butyl-4-methoxy-5-methylphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1c(C)cc(-c2cc(N)on2)cc1C(C)(C)C |
| InChI | InChI=1S/C15H20N2O2/c1-9-6-10(12-8-13(16)19-17-12)7-11(14(9)18-5)15(2,3)4/h6-8H,16H2,1-5H3 |
| InChIKey | BECINGBGVPEKHZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |