C16H23NO2 — CID 117408174
2-(6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)piperidine (PubChem CID 117408174) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-(6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)piperidine.
| Compound Name | 2-(6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)piperidine |
|---|---|
| PubChem CID | 117408174 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(6-ethyl-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)piperidine |
| SMILES | CCc1c(C2CCCCN2)ccc2c1OCCCO2 |
| InChI | InChI=1S/C16H23NO2/c1-2-12-13(14-6-3-4-9-17-14)7-8-15-16(12)19-11-5-10-18-15/h7-8,14,17H,2-6,9-11H2,1H3 |
| InChIKey | FUWKXOKZLFNRLR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |