C12H16ClNO2 — CID 171195463
(2R)-2-(1,3-benzodioxol-4-yl)piperidine;hydrochloride (PubChem CID 171195463) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-4-yl)piperidine;hydrochloride.
| Compound Name | (2R)-2-(1,3-benzodioxol-4-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 171195463 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-4-yl)piperidine;hydrochloride |
| SMILES | Cl.c1cc2c(c([C@H]3CCCCN3)c1)OCO2 |
| InChI | InChI=1S/C12H15NO2.ClH/c1-2-7-13-10(5-1)9-4-3-6-11-12(9)15-8-14-11;/h3-4,6,10,13H,1-2,5,7-8H2;1H/t10-;/m1./s1 |
| InChIKey | YSRJJWIABDBZGC-HNCPQSOCSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |