C13H18N2O2 — CID 82389708
[6-(1,3-benzodioxol-4-yl)piperidin-3-yl]methanamine (PubChem CID 82389708) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-4-yl)piperidin-3-yl]methanamine.
| Compound Name | [6-(1,3-benzodioxol-4-yl)piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 82389708 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [6-(1,3-benzodioxol-4-yl)piperidin-3-yl]methanamine |
| SMILES | NCC1CCC(c2cccc3c2OCO3)NC1 |
| InChI | InChI=1S/C13H18N2O2/c14-6-9-4-5-11(15-7-9)10-2-1-3-12-13(10)17-8-16-12/h1-3,9,11,15H,4-8,14H2 |
| InChIKey | XCJNARQZSBBIIY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |