C11H14ClNO3 — CID 171192633
(3R)-3-(1,3-benzodioxol-4-yl)morpholine;hydrochloride (PubChem CID 171192633) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is (3R)-3-(1,3-benzodioxol-4-yl)morpholine;hydrochloride.
| Compound Name | (3R)-3-(1,3-benzodioxol-4-yl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171192633 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3R)-3-(1,3-benzodioxol-4-yl)morpholine;hydrochloride |
| SMILES | Cl.c1cc2c(c([C@@H]3COCCN3)c1)OCO2 |
| InChI | InChI=1S/C11H13NO3.ClH/c1-2-8(9-6-13-5-4-12-9)11-10(3-1)14-7-15-11;/h1-3,9,12H,4-7H2;1H/t9-;/m0./s1 |
| InChIKey | UCPIXOCQDFVUCQ-FVGYRXGTSA-N |
| XLogP | 1.50 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |