C17H27NO — CID 117408731
2-(1-aminocyclopentyl)-3,6-di(propan-2-yl)phenol (PubChem CID 117408731) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(1-aminocyclopentyl)-3,6-di(propan-2-yl)phenol.
| Compound Name | 2-(1-aminocyclopentyl)-3,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 117408731 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-(1-aminocyclopentyl)-3,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1ccc(C(C)C)c(C2(N)CCCC2)c1O |
| InChI | InChI=1S/C17H27NO/c1-11(2)13-7-8-14(12(3)4)16(19)15(13)17(18)9-5-6-10-17/h7-8,11-12,19H,5-6,9-10,18H2,1-4H3 |
| InChIKey | VPIJABVCXSWYLL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|