C14H14O5 — CID 117409795
1-(8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)cyclobutane-1-carboxylic acid (PubChem CID 117409795) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 1-(8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117409795 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=Cc1ccc(C2(C(=O)O)CCC2)c2c1OCCO2 |
| InChI | InChI=1S/C14H14O5/c15-8-9-2-3-10(12-11(9)18-6-7-19-12)14(13(16)17)4-1-5-14/h2-3,8H,1,4-7H2,(H,16,17) |
| InChIKey | GOGJNTXWUUDXRN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|