C25H32N4 — CID 11741010
N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3,5,7-tetramethylquinolin-4-amine (PubChem CID 11741010) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3,5,7-tetramethylquinolin-4-amine.
| Compound Name | N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3,5,7-tetramethylquinolin-4-amine |
|---|---|
| PubChem CID | 11741010 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N-[4-(3,4-dimethylpiperazin-1-yl)phenyl]-2,3,5,7-tetramethylquinolin-4-amine |
| SMILES | Cc1cc(C)c2c(Nc3ccc(N4CCN(C)C(C)C4)cc3)c(C)c(C)nc2c1 |
| InChI | InChI=1S/C25H32N4/c1-16-13-17(2)24-23(14-16)26-20(5)19(4)25(24)27-21-7-9-22(10-8-21)29-12-11-28(6)18(3)15-29/h7-10,13-14,18H,11-12,15H2,1-6H3,(H,26,27) |
| InChIKey | ISQPPFGYKGDIHL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|