C29H32N4 — CID 12069888
Bis(3)-cognitin (PubChem CID 12069888) has the molecular formula C29H32N4 and a molecular weight of 436.60 g/mol. Its IUPAC name is N,N'-bis(1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine.
| Compound Name | Bis(3)-cognitin |
|---|---|
| PubChem CID | 12069888 |
| Molecular Formula | C29H32N4 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N,N'-bis(1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine |
| SMILES | C1CCC2=NC3=CC=CC=C3C(=C2C1)NCCCNC4=C5CCCCC5=NC6=CC=CC=C64 |
| InChI | InChI=1S/C29H32N4/c1-5-14-24-20(10-1)28(21-11-2-6-15-25(21)32-24)30-18-9-19-31-29-22-12-3-7-16-26(22)33-27-17-8-4-13-23(27)29/h1,3,5,7,10,12,14,16H,2,4,6,8-9,11,13,15,17-19H2,(H,30,32)(H,31,33) |
| InChIKey | BHOCVLCAWPPEOV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 49.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | 573 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|