C14H19IN2O3 — CID 11741085
5-iodo-2,3-dimethoxy-N-[[(2R)-pyrrolidin-2-yl]methyl]benzamide (PubChem CID 11741085) has the molecular formula C14H19IN2O3 and a molecular weight of 390.22 g/mol. Its IUPAC name is 5-iodo-2,3-dimethoxy-N-[[(2R)-pyrrolidin-2-yl]methyl]benzamide.
| Compound Name | 5-iodo-2,3-dimethoxy-N-[[(2R)-pyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11741085 |
| Molecular Formula | C14H19IN2O3 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 5-iodo-2,3-dimethoxy-N-[[(2R)-pyrrolidin-2-yl]methyl]benzamide |
| SMILES | COc1cc(I)cc(C(=O)NC[C@H]2CCCN2)c1OC |
| InChI | InChI=1S/C14H19IN2O3/c1-19-12-7-9(15)6-11(13(12)20-2)14(18)17-8-10-4-3-5-16-10/h6-7,10,16H,3-5,8H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | MCIOGCRYTUVGLE-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|