C17H24FIN2O3 — CID 23276511
N-[[1-(3-fluoropropyl)pyrrolidin-2-yl]methyl]-5-iodo-2,3-dimethoxybenzamide (PubChem CID 23276511) has the molecular formula C17H24FIN2O3 and a molecular weight of 450.29 g/mol. Its IUPAC name is N-[[1-(3-fluoropropyl)pyrrolidin-2-yl]methyl]-5-iodo-2,3-dimethoxybenzamide.
| Compound Name | N-[[1-(3-fluoropropyl)pyrrolidin-2-yl]methyl]-5-iodo-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 23276511 |
| Molecular Formula | C17H24FIN2O3 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-[[1-(3-fluoropropyl)pyrrolidin-2-yl]methyl]-5-iodo-2,3-dimethoxybenzamide |
| SMILES | COc1cc(I)cc(C(=O)NCC2CCCN2CCCF)c1OC |
| InChI | InChI=1S/C17H24FIN2O3/c1-23-15-10-12(19)9-14(16(15)24-2)17(22)20-11-13-5-3-7-21(13)8-4-6-18/h9-10,13H,3-8,11H2,1-2H3,(H,20,22) |
| InChIKey | AODFSZZCMKDUEK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|