C15H20Cl2N2O2 — CID 15167696
3,5-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-methoxybenzamide (PubChem CID 15167696) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 3,5-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 15167696 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3,5-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-methoxybenzamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)c1cc(Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-3-19-6-4-5-11(19)9-18-15(20)12-7-10(16)8-13(17)14(12)21-2/h7-8,11H,3-6,9H2,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | NFNSQRMKWTYCTF-NSHDSACASA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |