C12H13N3O4 — CID 117412042
5-(3-amino-1H-pyrazol-5-yl)-2,4-dimethoxybenzoic acid (PubChem CID 117412042) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-(3-amino-1H-pyrazol-5-yl)-2,4-dimethoxybenzoic acid.
| Compound Name | 5-(3-amino-1H-pyrazol-5-yl)-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 117412042 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-(3-amino-1H-pyrazol-5-yl)-2,4-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(-c2cc(N)n[nH]2)cc1C(=O)O |
| InChI | InChI=1S/C12H13N3O4/c1-18-9-5-10(19-2)7(12(16)17)3-6(9)8-4-11(13)15-14-8/h3-5H,1-2H3,(H,16,17)(H3,13,14,15) |
| InChIKey | YRMDCAQNULXHST-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |