C13H13NO3S — CID 117412599
6-(1-isocyanatocyclobutyl)-5-methoxy-1,3-benzoxathiole (PubChem CID 117412599) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 6-(1-isocyanatocyclobutyl)-5-methoxy-1,3-benzoxathiole.
| Compound Name | 6-(1-isocyanatocyclobutyl)-5-methoxy-1,3-benzoxathiole |
|---|---|
| PubChem CID | 117412599 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-(1-isocyanatocyclobutyl)-5-methoxy-1,3-benzoxathiole |
| SMILES | COc1cc2c(cc1C1(N=C=O)CCC1)OCS2 |
| InChI | InChI=1S/C13H13NO3S/c1-16-10-6-12-11(17-8-18-12)5-9(10)13(14-7-15)3-2-4-13/h5-6H,2-4,8H2,1H3 |
| InChIKey | PZNODENFUHCBFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|