C15H21NO3 — CID 117412991
4-amino-4-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)butanoic acid (PubChem CID 117412991) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-amino-4-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)butanoic acid.
| Compound Name | 4-amino-4-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)butanoic acid |
|---|---|
| PubChem CID | 117412991 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-amino-4-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)butanoic acid |
| SMILES | NC(CCC(=O)O)c1c(O)ccc2c1CCCCC2 |
| InChI | InChI=1S/C15H21NO3/c16-12(7-9-14(18)19)15-11-5-3-1-2-4-10(11)6-8-13(15)17/h6,8,12,17H,1-5,7,9,16H2,(H,18,19) |
| InChIKey | CTMHJAZVOOXRAV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|