C12H15NO2 — CID 142761664
2-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 142761664) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 142761664 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | NC(=O)Cc1c(O)ccc2c1CCCC2 |
| InChI | InChI=1S/C12H15NO2/c13-12(15)7-10-9-4-2-1-3-8(9)5-6-11(10)14/h5-6,14H,1-4,7H2,(H2,13,15) |
| InChIKey | GFZNWSOVGCJALG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |