C11H15NO2 — CID 117283819
4-[(methoxyamino)methyl]-2,3-dihydro-1H-inden-5-ol (PubChem CID 117283819) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-[(methoxyamino)methyl]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 4-[(methoxyamino)methyl]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 117283819 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-[(methoxyamino)methyl]-2,3-dihydro-1H-inden-5-ol |
| SMILES | CONCc1c(O)ccc2c1CCC2 |
| InChI | InChI=1S/C11H15NO2/c1-14-12-7-10-9-4-2-3-8(9)5-6-11(10)13/h5-6,12-13H,2-4,7H2,1H3 |
| InChIKey | YJABORPRKAEFCB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|