C12H17NO2 — CID 117296336
N-methoxy-1-(5-methoxy-2,3-dihydro-1H-inden-4-yl)methanamine (PubChem CID 117296336) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-methoxy-1-(5-methoxy-2,3-dihydro-1H-inden-4-yl)methanamine.
| Compound Name | N-methoxy-1-(5-methoxy-2,3-dihydro-1H-inden-4-yl)methanamine |
|---|---|
| PubChem CID | 117296336 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-methoxy-1-(5-methoxy-2,3-dihydro-1H-inden-4-yl)methanamine |
| SMILES | CONCc1c(OC)ccc2c1CCC2 |
| InChI | InChI=1S/C12H17NO2/c1-14-12-7-6-9-4-3-5-10(9)11(12)8-13-15-2/h6-7,13H,3-5,8H2,1-2H3 |
| InChIKey | ZBXVBOLEKPQAKM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|