C11H12ClF2NO2 — CID 117413959
4-amino-4-[2-chloro-4-(difluoromethyl)phenyl]butanoic acid (PubChem CID 117413959) has the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. Its IUPAC name is 4-amino-4-[2-chloro-4-(difluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[2-chloro-4-(difluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117413959 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-amino-4-[2-chloro-4-(difluoromethyl)phenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1ccc(C(F)F)cc1Cl |
| InChI | InChI=1S/C11H12ClF2NO2/c12-8-5-6(11(13)14)1-2-7(8)9(15)3-4-10(16)17/h1-2,5,9,11H,3-4,15H2,(H,16,17) |
| InChIKey | IEWJJKCDXGXMJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |