C12H15F2NO3 — CID 117401237
4-amino-4-[4-(difluoromethyl)-2-methoxyphenyl]butanoic acid (PubChem CID 117401237) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 4-amino-4-[4-(difluoromethyl)-2-methoxyphenyl]butanoic acid.
| Compound Name | 4-amino-4-[4-(difluoromethyl)-2-methoxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 117401237 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-amino-4-[4-(difluoromethyl)-2-methoxyphenyl]butanoic acid |
| SMILES | COc1cc(C(F)F)ccc1C(N)CCC(=O)O |
| InChI | InChI=1S/C12H15F2NO3/c1-18-10-6-7(12(13)14)2-3-8(10)9(15)4-5-11(16)17/h2-3,6,9,12H,4-5,15H2,1H3,(H,16,17) |
| InChIKey | AXHAYRJNYNWIGH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |