C14H14ClNO2 — CID 117414054
7-chloro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran (PubChem CID 117414054) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 7-chloro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 7-chloro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 117414054 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 7-chloro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran |
| SMILES | O=C=NC1(c2cc(Cl)c3c(c2)CCO3)CCCC1 |
| InChI | InChI=1S/C14H14ClNO2/c15-12-8-11(7-10-3-6-18-13(10)12)14(16-9-17)4-1-2-5-14/h7-8H,1-6H2 |
| InChIKey | OLAYXHPMAFQRKB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|