C13H14ClN3O — CID 117414117
5-(5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrazol-3-amine (PubChem CID 117414117) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 5-(5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117414117 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 5-(5-chloro-2,2-dimethyl-3H-1-benzofuran-7-yl)-1H-pyrazol-3-amine |
| SMILES | CC1(C)Cc2cc(Cl)cc(-c3cc(N)n[nH]3)c2O1 |
| InChI | InChI=1S/C13H14ClN3O/c1-13(2)6-7-3-8(14)4-9(12(7)18-13)10-5-11(15)17-16-10/h3-5H,6H2,1-2H3,(H3,15,16,17) |
| InChIKey | CFXZARPJCFQRFH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |