About 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine
3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine (PubChem CID 11741686) has the molecular formula C15H11Cl2N3O2S2
and a molecular weight of 400.31 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine |
| PubChem CID | 11741686 |
| Molecular Formula | C15H11Cl2N3O2S2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine |
| SMILES | [H]/N=c1/c(S(=O)(=O)c2ccc(Cl)c(Cl)c2)c(SC)nc2ccccn12 |
| InChI | InChI=1S/C15H11Cl2N3O2S2/c1-23-15-13(14(18)20-7-3-2-4-12(20)19-15)24(21,22)9-5-6-10(16)11(17)8-9/h2-8,18H,1H3/b18-14- |
| InChIKey | ZUCOHROUXWRQLI-JXAWBTAJSA-N |
| XLogP | 3.68 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine?
The IUPAC name of 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine (CID 11741686) is 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine.
What is the SMILES notation for 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine?
The canonical SMILES for 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine is [H]/N=c1/c(S(=O)(=O)c2ccc(Cl)c(Cl)c2)c(SC)nc2ccccn12.
What is the InChIKey of 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine?
The InChIKey is ZUCOHROUXWRQLI-JXAWBTAJSA-N. The full InChI is InChI=1S/C15H11Cl2N3O2S2/c1-23-15-13(14(18)20-7-3-2-4-12(20)19-15)24(21,22)9-5-6-10(16)11(17)8-9/h2-8,18H,1H3/b18-14-.
What are the key properties of 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine?
3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine has a molecular weight of 400.31 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)sulfonyl-2-methylsulfanylpyrido[1,2-a]pyrimidin-4-imine is sourced from PubChem (CID 11741686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).