C12H7Cl2N3 — CID 18992433
1,4-dichloropyrido[2,1-b]quinazolin-11-imine (PubChem CID 18992433) has the molecular formula C12H7Cl2N3 and a molecular weight of 264.12 g/mol. Its IUPAC name is 1,4-dichloropyrido[2,1-b]quinazolin-11-imine.
| Compound Name | 1,4-dichloropyrido[2,1-b]quinazolin-11-imine |
|---|---|
| PubChem CID | 18992433 |
| Molecular Formula | C12H7Cl2N3 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 1,4-dichloropyrido[2,1-b]quinazolin-11-imine |
| SMILES | [H]/N=c1/c2c(Cl)ccc(Cl)c2nc2ccccn12 |
| InChI | InChI=1S/C12H7Cl2N3/c13-7-4-5-8(14)11-10(7)12(15)17-6-2-1-3-9(17)16-11/h1-6,15H/b15-12- |
| InChIKey | PAPSIDATUZYNSY-QINSGFPZSA-N |
| XLogP | 3.27 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|