methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate

C14H19NO4 — CID 117417244

IUPACmethyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate
SMILESCOC(=O)c1cc(CC2CCCNC2)c(O)cc1O
InChIInChI=1S/C14H19NO4/c1-19-14(18)11-6-10(12(16)7-13(11)17)5-9-3-2-4-15-8-9/h6-7,9,15-17H,2-5,8H2,1H3
InChIKeyDVZKHYAGGZZZSD-UHFFFAOYSA-N
MW265.31 g/mol
LogP1.43
Rot. Bonds3

About methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate

methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate (PubChem CID 117417244) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate.

Molecular Properties

Compound Namemethyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate
PubChem CID117417244
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Namemethyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate
SMILESCOC(=O)c1cc(CC2CCCNC2)c(O)cc1O
InChIInChI=1S/C14H19NO4/c1-19-14(18)11-6-10(12(16)7-13(11)17)5-9-3-2-4-15-8-9/h6-7,9,15-17H,2-5,8H2,1H3
InChIKeyDVZKHYAGGZZZSD-UHFFFAOYSA-N
XLogP1.43
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate?
The IUPAC name of methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate (CID 117417244) is methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate.
What is the SMILES notation for methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate?
The canonical SMILES for methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate is COC(=O)c1cc(CC2CCCNC2)c(O)cc1O.
What is the InChIKey of methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate?
The InChIKey is DVZKHYAGGZZZSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-19-14(18)11-6-10(12(16)7-13(11)17)5-9-3-2-4-15-8-9/h6-7,9,15-17H,2-5,8H2,1H3.
What are the key properties of methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate?
methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate has a molecular weight of 265.31 g/mol, XLogP of 1.43, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dihydroxy-5-(piperidin-3-ylmethyl)benzoate is sourced from PubChem (CID 117417244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).