C14H19NO4 — CID 117417249
methyl 2,4-dihydroxy-5-(piperidin-4-ylmethyl)benzoate (PubChem CID 117417249) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 2,4-dihydroxy-5-(piperidin-4-ylmethyl)benzoate.
| Compound Name | methyl 2,4-dihydroxy-5-(piperidin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 117417249 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl 2,4-dihydroxy-5-(piperidin-4-ylmethyl)benzoate |
| SMILES | COC(=O)c1cc(CC2CCNCC2)c(O)cc1O |
| InChI | InChI=1S/C14H19NO4/c1-19-14(18)11-7-10(12(16)8-13(11)17)6-9-2-4-15-5-3-9/h7-9,15-17H,2-6H2,1H3 |
| InChIKey | ZNJXEEBOOXSPGB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |