3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid

C14H19NO4 — CID 117417276

IUPAC3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid
SMILESCOc1cc(C(=O)O)cc(CC2CCCN2)c1OC
InChIInChI=1S/C14H19NO4/c1-18-12-8-10(14(16)17)6-9(13(12)19-2)7-11-4-3-5-15-11/h6,8,11,15H,3-5,7H2,1-2H3,(H,16,17)
InChIKeyYQVSVHVVKIGYDV-UHFFFAOYSA-N
MW265.31 g/mol
LogP1.70
Rot. Bonds5

About 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid

3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid (PubChem CID 117417276) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid.

Molecular Properties

Compound Name3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid
PubChem CID117417276
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Name3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid
SMILESCOc1cc(C(=O)O)cc(CC2CCCN2)c1OC
InChIInChI=1S/C14H19NO4/c1-18-12-8-10(14(16)17)6-9(13(12)19-2)7-11-4-3-5-15-11/h6,8,11,15H,3-5,7H2,1-2H3,(H,16,17)
InChIKeyYQVSVHVVKIGYDV-UHFFFAOYSA-N
XLogP1.70
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid?
The IUPAC name of 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid (CID 117417276) is 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid.
What is the SMILES notation for 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid?
The canonical SMILES for 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid is COc1cc(C(=O)O)cc(CC2CCCN2)c1OC.
What is the InChIKey of 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid?
The InChIKey is YQVSVHVVKIGYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-18-12-8-10(14(16)17)6-9(13(12)19-2)7-11-4-3-5-15-11/h6,8,11,15H,3-5,7H2,1-2H3,(H,16,17).
What are the key properties of 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid?
3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid has a molecular weight of 265.31 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzoic acid is sourced from PubChem (CID 117417276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).