C21H26ClN3O3 — CID 11741926
N-(4-amino-5-chloro-2-ethoxyphenyl)-2-(4-benzylmorpholin-2-yl)acetamide (PubChem CID 11741926) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is N-(4-amino-5-chloro-2-ethoxyphenyl)-2-(4-benzylmorpholin-2-yl)acetamide.
| Compound Name | N-(4-amino-5-chloro-2-ethoxyphenyl)-2-(4-benzylmorpholin-2-yl)acetamide |
|---|---|
| PubChem CID | 11741926 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-(4-amino-5-chloro-2-ethoxyphenyl)-2-(4-benzylmorpholin-2-yl)acetamide |
| SMILES | CCOc1cc(N)c(Cl)cc1NC(=O)CC1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-2-27-20-12-18(23)17(22)11-19(20)24-21(26)10-16-14-25(8-9-28-16)13-15-6-4-3-5-7-15/h3-7,11-12,16H,2,8-10,13-14,23H2,1H3,(H,24,26) |
| InChIKey | IGIATIGOCHJDLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|