C14H22N2O3 — CID 117420119
6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2,3-dimethoxyphenol (PubChem CID 117420119) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2,3-dimethoxyphenol.
| Compound Name | 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 117420119 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2,3-dimethoxyphenol |
| SMILES | COc1ccc(C2CC(CN)CN2C)c(O)c1OC |
| InChI | InChI=1S/C14H22N2O3/c1-16-8-9(7-15)6-11(16)10-4-5-12(18-2)14(19-3)13(10)17/h4-5,9,11,17H,6-8,15H2,1-3H3 |
| InChIKey | XAEQFQRTCLPLSR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|