C18H28N2O2 — CID 117489816
[5-(2-cyclopentyloxy-3-methoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117489816) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is [5-(2-cyclopentyloxy-3-methoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [5-(2-cyclopentyloxy-3-methoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117489816 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [5-(2-cyclopentyloxy-3-methoxyphenyl)-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | COc1cccc(C2CC(CN)CN2C)c1OC1CCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-20-12-13(11-19)10-16(20)15-8-5-9-17(21-2)18(15)22-14-6-3-4-7-14/h5,8-9,13-14,16H,3-4,6-7,10-12,19H2,1-2H3 |
| InChIKey | JCVDIGXFEGQFKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |